| MolName | N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C24H28N7OCl |
| Smiles | Clc(cccc1)c1-c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)o1 |
| InChI | InChI=1S/C24H28ClN7O/c25-20-10-4-3-9-19(20)21-12-11-18(33-21)17-26-30-22-27-23(31-13-5-1-6-14-31)29-24(28-22)32-15-7-2-8-16-32/h3-4,9-12,17H,1-2,5-8,13-16H2,(H,27,28,29,30) |
| InChIK | FMXKFJFONBKMMO-UHFFFAOYSA-N |
| TotalMolweight | 465.987 |
| Molweight | 465.987 |
| MonoisotopicMass | 465.204385 |
| CLogP | 7.4734 |
| CLogS | -7.515 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 361.59 |
| Relative PSA | 0.2132 |
| PolarSurfaceArea | 82.68 |
| Druglikeness | 4.3347 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine