| MolName | 2-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| MolecularFormula | C24H16N6O2Cl2S2 |
| Smiles | N#Cc1c(/N=C\c(cc2)cc([N+]([O-])=O)c2Sc2n[nH]c(-c(ccc(Cl)c3)c3Cl)n2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H16Cl2N6O2S2/c25-14-6-7-16(18(26)10-14)22-29-24(31-30-22)36-21-8-5-13(9-19(21)32(33)34)12-28-23-17(11-27)15-3-1-2-4-20(15)35-23/h5-10,12H,1-4H2,(H,29,30,31) |
| InChIK | FNFQCYVJACNODE-UHFFFAOYSA-N |
| TotalMolweight | 555.469 |
| Molweight | 555.469 |
| MonoisotopicMass | 554.015318 |
| CLogP | 5.8485 |
| CLogS | -9.765 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 395.58 |
| Relative PSA | 0.32679 |
| PolarSurfaceArea | 177.08 |
| Druglikeness | -10.739 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile | 2 - 2-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile