| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-1H-indole-2-carboxamide |
| MolecularFormula | C24H17N3O |
| Smiles | O=C(c1cc(cccc2)c2[nH]1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C24H17N3O/c28-24(23-14-18-9-3-6-12-22(18)26-23)27-25-15-21-19-10-4-1-7-16(19)13-17-8-2-5-11-20(17)21/h1-15,26H,(H,27,28) |
| InChIK | FNOIRSNOZXXLLK-UHFFFAOYSA-N |
| TotalMolweight | 363.419 |
| Molweight | 363.419 |
| MonoisotopicMass | 363.137162 |
| CLogP | 5.6838 |
| CLogS | -7.482 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 280.36 |
| Relative PSA | 0.17834 |
| PolarSurfaceArea | 57.25 |
| Druglikeness | 5.5953 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-1H-indole-2-carboxamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-1H-indole-2-carboxamide