| MolName | (E)-3-(3-bromophenyl)-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| MolecularFormula | C22H14N2OBrI |
| Smiles | Brc1cccc(/C=C/C=N/c(cc2)cc3c2oc(-c2cccc(I)c2)n3)c1 |
| InChI | InChI=1S/C22H14BrIN2O/c23-17-7-1-4-15(12-17)5-3-11-25-19-9-10-21-20(14-19)26-22(27-21)16-6-2-8-18(24)13-16/h1-14H |
| InChIK | FNOQVIOKBIETRC-UHFFFAOYSA-N |
| TotalMolweight | 529.17 |
| Molweight | 529.17 |
| MonoisotopicMass | 527.933422 |
| CLogP | 5.8688 |
| CLogS | -8.29 |
| H Acceptors | 3 |
| TotalSurfaceArea | 312 |
| Relative PSA | 0.11728 |
| PolarSurfaceArea | 38.39 |
| Druglikeness | -1.1029 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(3-bromophenyl)-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine | 2 - (E)-3-(3-bromophenyl)-N-[2-(3-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine