| MolName | N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-2,4-dinitroaniline |
| MolecularFormula | C15H11N8O4Br |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\Cc1nnnn1-c(cc1)ccc1Br)=O |
| InChI | InChI=1S/C15H11BrN8O4/c16-10-1-3-11(4-2-10)22-15(19-20-21-22)7-8-17-18-13-6-5-12(23(25)26)9-14(13)24(27)28/h1-6,8-9,18H,7H2 |
| InChIK | FNYFZHGRSSYGMM-UHFFFAOYSA-N |
| TotalMolweight | 447.208 |
| Molweight | 447.208 |
| MonoisotopicMass | 446.008663 |
| CLogP | 2.1982 |
| CLogS | -4.373 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 294.21 |
| Relative PSA | 0.42007 |
| PolarSurfaceArea | 159.63 |
| Druglikeness | -5.3389 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-2,4-dinitroaniline | 2 - N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-2,4-dinitroaniline