| MolName | N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C24H21N3O4 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C24H21N3O4/c28-22(27-26-14-17-11-12-20-21(13-17)31-16-30-20)15-25-24(29)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,23H,15-16H2,(H,25,29)(H,27,28) |
| InChIK | FOSKKYNMYNPEGP-UHFFFAOYSA-N |
| TotalMolweight | 415.448 |
| Molweight | 415.448 |
| MonoisotopicMass | 415.153207 |
| CLogP | 3.9224 |
| CLogS | -5.313 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 322.48 |
| Relative PSA | 0.24966 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 6.183 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide