| MolName | N,N'-bis[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]decanediamide |
| MolecularFormula | C30H38N4O2 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c1cc(CCC2)c2cc1)=O)N/N=C\c1cc(CCC2)c2cc1 |
| InChI | InChI=1S/C30H38N4O2/c35-29(33-31-21-23-15-17-25-9-7-11-27(25)19-23)13-5-3-1-2-4-6-14-30(36)34-32-22-24-16-18-26-10-8-12-28(26)20-24/h15-22H,1-14H2,(H,33,35)(H,34,36) |
| InChIK | FOUVZCAFPUVDLK-UHFFFAOYSA-N |
| TotalMolweight | 486.658 |
| Molweight | 486.658 |
| MonoisotopicMass | 486.299476 |
| CLogP | 7.8032 |
| CLogS | -7.922 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 406.6 |
| Relative PSA | 0.17713 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.1295 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 13 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 14 |
| Symmetricatoms | 18 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]decanediamide | 2 - N,N'-bis[(Z)-2,3-dihydro-1H-inden-5-ylmethylideneamino]decanediamide