| MolName | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide |
| MolecularFormula | C16H21N3O2F2 |
| Smiles | O=C(CCN1CCCCC1)N/N=C\c(cccc1)c1OC(F)F |
| InChI | InChI=1S/C16H21F2N3O2/c17-16(18)23-14-7-3-2-6-13(14)12-19-20-15(22)8-11-21-9-4-1-5-10-21/h2-3,6-7,12,16H,1,4-5,8-11H2,(H,20,22) |
| InChIK | FOXJSHRRQGCAGY-UHFFFAOYSA-N |
| TotalMolweight | 325.358 |
| Molweight | 325.358 |
| MonoisotopicMass | 325.160183 |
| CLogP | 2.8081 |
| CLogS | -3.522 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 255.55 |
| Relative PSA | 0.19393 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 2.3838 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 10 |
| Symmetricatoms | 3 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide | 2 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide