| MolName | 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C19H24N4O3 |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H24N4O3/c24-17-19(8-2-1-3-9-19)21-18(25)23(17)20-14-15-4-6-16(7-5-15)22-10-12-26-13-11-22/h4-7,14H,1-3,8-13H2,(H,21,25) |
| InChIK | FPEWCQZOCDZNFJ-UHFFFAOYSA-N |
| TotalMolweight | 356.425 |
| Molweight | 356.425 |
| MonoisotopicMass | 356.184841 |
| CLogP | 1.8198 |
| CLogS | -3.839 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 269.33 |
| Relative PSA | 0.24561 |
| PolarSurfaceArea | 74.24 |
| Druglikeness | 1.7944 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione