| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C16H9N4Cl2F3S |
| Smiles | FC(c1ccc(/C=N\N(C(c(ccc(Cl)c2)c2Cl)=NN2)C2=S)cc1)(F)F |
| InChI | InChI=1S/C16H9Cl2F3N4S/c17-11-5-6-12(13(18)7-11)14-23-24-15(26)25(14)22-8-9-1-3-10(4-2-9)16(19,20)21/h1-8H,(H,24,26) |
| InChIK | FPJKSEWINPFALO-UHFFFAOYSA-N |
| TotalMolweight | 417.241 |
| Molweight | 417.241 |
| MonoisotopicMass | 415.987704 |
| CLogP | 5.3553 |
| CLogS | -6.701 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 282.02 |
| Relative PSA | 0.23413 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | -3.5755 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione