| MolName | 5-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-11-(4-chlorophenyl)-13-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| MolecularFormula | C29H17N4O4Cl |
| Smiles | O=C(c(oc1c2c(-c3ccccc3)cc(-c(cc3)ccc3Cl)n1)c2N=C1)N1/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C29H17ClN4O4/c30-20-9-7-19(8-10-20)22-13-21(18-4-2-1-3-5-18)25-26-27(38-28(25)33-22)29(35)34(15-31-26)32-14-17-6-11-23-24(12-17)37-16-36-23/h1-15H,16H2 |
| InChIK | FPUPIPDRWNZMRQ-UHFFFAOYSA-N |
| TotalMolweight | 520.931 |
| Molweight | 520.931 |
| MonoisotopicMass | 520.093833 |
| CLogP | 6.3864 |
| CLogS | -10.343 |
| H Acceptors | 8 |
| TotalSurfaceArea | 375.34 |
| Relative PSA | 0.22564 |
| PolarSurfaceArea | 89.52 |
| Druglikeness | 4.4957 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-11-(4-chlorophenyl)-13-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one | 2 - 5-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-11-(4-chlorophenyl)-13-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one