| MolName | N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| MolecularFormula | C25H27N5O4S2 |
| Smiles | O=C(c1cccc(S(N2CCCC2)(=O)=O)c1)N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H27N5O4S2/c31-24(20-9-6-10-21(17-20)36(32,33)30-11-4-5-12-30)28-26-18-22-23(19-7-2-1-3-8-19)27-25(35-22)29-13-15-34-16-14-29/h1-3,6-10,17-18H,4-5,11-16H2,(H,28,31) |
| InChIK | FQEQFDVHSZPCQG-UHFFFAOYSA-N |
| TotalMolweight | 525.652 |
| Molweight | 525.652 |
| MonoisotopicMass | 525.150445 |
| CLogP | 4.1931 |
| CLogS | -5.27 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 383.71 |
| Relative PSA | 0.29455 |
| PolarSurfaceArea | 140.82 |
| Druglikeness | 1.5528 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide