| MolName | 2-[4-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C21H27N7O4 |
| Smiles | OC(COc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCCCC3)n2)cc1)=O |
| InChI | InChI=1S/C21H27N7O4/c29-18(30)15-32-17-6-4-16(5-7-17)14-22-26-19-23-20(27-8-2-1-3-9-27)25-21(24-19)28-10-12-31-13-11-28/h4-7,14H,1-3,8-13,15H2,(H,29,30)(H,23,24,25,26) |
| InChIK | FQGNBMMZVHUUEW-UHFFFAOYSA-N |
| TotalMolweight | 441.49 |
| Molweight | 441.49 |
| MonoisotopicMass | 441.212453 |
| CLogP | 3.3133 |
| CLogS | -4.223 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 340.82 |
| Relative PSA | 0.32017 |
| PolarSurfaceArea | 125.3 |
| Druglikeness | 1.6921 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid