| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| MolecularFormula | C27H21N5OS |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H21N5OS/c33-25(29-28-18-22-14-9-13-20-10-7-8-17-24(20)22)19-34-27-31-30-26(21-11-3-1-4-12-21)32(27)23-15-5-2-6-16-23/h1-18H,19H2,(H,29,33) |
| InChIK | FQTSCOUWVHZVMP-UHFFFAOYSA-N |
| TotalMolweight | 463.564 |
| Molweight | 463.564 |
| MonoisotopicMass | 463.14668 |
| CLogP | 5.7262 |
| CLogS | -10.022 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 359.08 |
| Relative PSA | 0.22922 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 5.4255 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide