| MolName | [(Z)-isoquinolin-1-ylmethylideneamino]thiourea |
| MolecularFormula | C11H10N4S |
| Smiles | NC(N/N=C\c1nccc2ccccc12)=S |
| InChI | InChI=1S/C11H10N4S/c12-11(16)15-14-7-10-9-4-2-1-3-8(9)5-6-13-10/h1-7H,(H3,12,15,16) |
| InChIK | FQWITMQQUMTMRE-UHFFFAOYSA-N |
| TotalMolweight | 230.294 |
| Molweight | 230.294 |
| MonoisotopicMass | 230.062616 |
| CLogP | 1.7795 |
| CLogS | -3.733 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 184.07 |
| Relative PSA | 0.41946 |
| PolarSurfaceArea | 95.39 |
| Druglikeness | 2.2769 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-isoquinolin-1-ylmethylideneamino]thiourea | 2 - [(Z)-isoquinolin-1-ylmethylideneamino]thiourea