| MolName | 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| MolecularFormula | C26H24N4O2Br2S2 |
| Smiles | O=C(CSCc(cccc1)c1Br)N/N=C\c1ccc(/C=N\NC(CSCc(cccc2)c2Br)=O)cc1 |
| InChI | InChI=1S/C26H24Br2N4O2S2/c27-23-7-3-1-5-21(23)15-35-17-25(33)31-29-13-19-9-11-20(12-10-19)14-30-32-26(34)18-36-16-22-6-2-4-8-24(22)28/h1-14H,15-18H2,(H,31,33)(H,32,34) |
| InChIK | FQYAVIGTTBMDMM-UHFFFAOYSA-N |
| TotalMolweight | 648.443 |
| Molweight | 648.443 |
| MonoisotopicMass | 645.970738 |
| CLogP | 6.5732 |
| CLogS | -9.066 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 428 |
| Relative PSA | 0.25 |
| PolarSurfaceArea | 133.52 |
| Druglikeness | 2.8785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide | 2 - 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide