| MolName | 2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]ethanol |
| MolecularFormula | C9H11N2OCl |
| Smiles | OCCN/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C9H11ClN2O/c10-9-3-1-8(2-4-9)7-12-11-5-6-13/h1-4,7,11,13H,5-6H2 |
| InChIK | FRFHTGYBQFWVIH-UHFFFAOYSA-N |
| TotalMolweight | 198.652 |
| Molweight | 198.652 |
| MonoisotopicMass | 198.05599 |
| CLogP | 1.7867 |
| CLogS | -2.798 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 158.77 |
| Relative PSA | 0.22718 |
| PolarSurfaceArea | 44.62 |
| Druglikeness | 2.6075 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.84615 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]ethanol | 2 - 2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]ethanol