| MolName | N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-4-fluorobenzamide |
| MolecularFormula | C24H24N3O2F |
| Smiles | O=C(c(cc1)ccc1F)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1 |
| InChI | InChI=1S/C24H24FN3O2/c25-22-10-8-19(9-11-22)24(29)27-26-17-21-7-6-20(16-18-4-2-1-3-5-18)23(21)28-12-14-30-15-13-28/h1-5,8-11,16-17H,6-7,12-15H2,(H,27,29) |
| InChIK | FSHRNGKZGYKYIJ-UHFFFAOYSA-N |
| TotalMolweight | 405.472 |
| Molweight | 405.472 |
| MonoisotopicMass | 405.185255 |
| CLogP | 3.8819 |
| CLogS | -4.601 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 316.83 |
| Relative PSA | 0.15642 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 3.3244 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-4-fluorobenzamide | 2 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-4-fluorobenzamide