| MolName | [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C21H13N3O5Br2 |
| Smiles | N#Cc(cccc1)c1OCC(N/N=C\c1cc(Br)cc(Br)c1OC(c1ccco1)=O)=O |
| InChI | InChI=1S/C21H13Br2N3O5/c22-15-8-14(20(16(23)9-15)31-21(28)18-6-3-7-29-18)11-25-26-19(27)12-30-17-5-2-1-4-13(17)10-24/h1-9,11H,12H2,(H,26,27) |
| InChIK | FSQHZVGNOCOIDF-UHFFFAOYSA-N |
| TotalMolweight | 547.158 |
| Molweight | 547.158 |
| MonoisotopicMass | 544.922194 |
| CLogP | 4.6817 |
| CLogS | -7.094 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 346.92 |
| Relative PSA | 0.2788 |
| PolarSurfaceArea | 113.92 |
| Druglikeness | -1.8215 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate