| MolName | 2-(4-fluorophenyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]quinoline-4-carboxamide |
| MolecularFormula | C24H15N3OF4 |
| Smiles | O=C(c1cc(-c(cc2)ccc2F)nc2ccccc12)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H15F4N3O/c25-18-11-7-16(8-12-18)22-13-20(19-3-1-2-4-21(19)30-22)23(32)31-29-14-15-5-9-17(10-6-15)24(26,27)28/h1-14H,(H,31,32) |
| InChIK | FTBHVCRJTKUISB-UHFFFAOYSA-N |
| TotalMolweight | 437.395 |
| Molweight | 437.395 |
| MonoisotopicMass | 437.115124 |
| CLogP | 6.2169 |
| CLogS | -7.297 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 315.92 |
| Relative PSA | 0.14871 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | -2.7213 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-fluorophenyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]quinoline-4-carboxamide | 2 - 2-(4-fluorophenyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]quinoline-4-carboxamide