| MolName | 2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate |
| MolecularFormula | C16H12N3O6 |
| Smiles | [O-]c(c(/C=N\NC([C@H]1Oc(cccc2)c2OC1)=O)ccc1)c1[N+]([O-])=O |
| InChI | InChI=1S/C16H13N3O6/c20-15-10(4-3-5-11(15)19(22)23)8-17-18-16(21)14-9-24-12-6-1-2-7-13(12)25-14/h1-8,14,20H,9H2,(H,18,21)/p-1/t14-/m0/s1 |
| InChIK | FTHRCKNDVXGPHI-AWEZNQCLSA-M |
| TotalMolweight | 342.286 |
| Molweight | 342.286 |
| MonoisotopicMass | 342.072612 |
| CLogP | -0.1016 |
| CLogS | -3.907 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 250.95 |
| Relative PSA | 0.40131 |
| PolarSurfaceArea | 128.8 |
| Druglikeness | -0.145 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate | 2 - 2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate