| MolName | 2-[3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-[3-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| MolecularFormula | C20H16N8O2F6 |
| Smiles | O=C(Cn1nc(C(F)(F)F)cc1)N/N=C\c1cccc(/C=N\NC(Cn2nc(C(F)(F)F)cc2)=O)c1 |
| InChI | InChI=1S/C20H16F6N8O2/c21-19(22,23)15-4-6-33(31-15)11-17(35)29-27-9-13-2-1-3-14(8-13)10-28-30-18(36)12-34-7-5-16(32-34)20(24,25)26/h1-10H,11-12H2,(H,29,35)(H,30,36) |
| InChIK | FTNZVMSJUBFPPM-UHFFFAOYSA-N |
| TotalMolweight | 514.389 |
| Molweight | 514.389 |
| MonoisotopicMass | 514.13004 |
| CLogP | 1.662 |
| CLogS | -3.898 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 363.08 |
| Relative PSA | 0.29663 |
| PolarSurfaceArea | 118.56 |
| Druglikeness | -5.4088 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63889 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Symmetricatoms | 19 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-[3-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide | 2 - 2-[3-(trifluoromethyl)pyrazol-1-yl]-N-[(Z)-[3-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide