| MolName | [4-[(Z)-[[2-(3-chloro-4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
| MolecularFormula | C25H21N3O5Cl2 |
| Smiles | CCOc(cc(/C=N\NC(C(Nc1cc(Cl)c(C)cc1)=O)=O)cc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C25H21Cl2N3O5/c1-3-34-22-12-16(5-11-21(22)35-25(33)17-6-8-18(26)9-7-17)14-28-30-24(32)23(31)29-19-10-4-15(2)20(27)13-19/h4-14H,3H2,1-2H3,(H,29,31)(H,30,32) |
| InChIK | FTODYVHKWNHRHB-UHFFFAOYSA-N |
| TotalMolweight | 514.364 |
| Molweight | 514.364 |
| MonoisotopicMass | 513.085826 |
| CLogP | 5.4666 |
| CLogS | -7.129 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 382.83 |
| Relative PSA | 0.24436 |
| PolarSurfaceArea | 106.09 |
| Druglikeness | 2.0133 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(3-chloro-4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate | 2 - [4-[(Z)-[[2-(3-chloro-4-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate