| MolName | N-[(Z)-(2,4-difluorophenyl)methylideneamino]quinolin-2-amine |
| MolecularFormula | C16H11N3F2 |
| Smiles | Fc1cc(F)c(/C=N\Nc2nc3ccccc3cc2)cc1 |
| InChI | InChI=1S/C16H11F2N3/c17-13-7-5-12(14(18)9-13)10-19-21-16-8-6-11-3-1-2-4-15(11)20-16/h1-10H,(H,20,21) |
| InChIK | FTPJGHQUVSKBTP-UHFFFAOYSA-N |
| TotalMolweight | 283.28 |
| Molweight | 283.28 |
| MonoisotopicMass | 283.092103 |
| CLogP | 5.7099 |
| CLogS | -5.008 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 215.3 |
| Relative PSA | 0.15764 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]quinolin-2-amine | 2 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]quinolin-2-amine