| MolName | 3-[[4-chloro-2-oxo-5-[(Z)-(phenylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoic acid |
| MolecularFormula | C18H14N3O3ClS |
| Smiles | OC(c1cccc(CN(C(Cl)=C(/C=N\Nc2ccccc2)S2)C2=O)c1)=O |
| InChI | InChI=1S/C18H14ClN3O3S/c19-16-15(10-20-21-14-7-2-1-3-8-14)26-18(25)22(16)11-12-5-4-6-13(9-12)17(23)24/h1-10,21H,11H2,(H,23,24) |
| InChIK | FTRYOLWOFSWBTH-UHFFFAOYSA-N |
| TotalMolweight | 387.846 |
| Molweight | 387.846 |
| MonoisotopicMass | 387.044439 |
| CLogP | 4.6963 |
| CLogS | -4.769 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 277.48 |
| Relative PSA | 0.29981 |
| PolarSurfaceArea | 107.3 |
| Druglikeness | 5.6267 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-2-oxo-5-[(Z)-(phenylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoic acid | 2 - 3-[[4-chloro-2-oxo-5-[(Z)-(phenylhydrazinylidene)methyl]-1,3-thiazol-3-yl]methyl]benzoic acid