| MolName | 3-[(Z)-[4-(1-benzofuran-2-yl)-2-benzylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| MolecularFormula | C25H19N3O2S |
| Smiles | Oc1cccc(/C=N\N(C(c2cc(cccc3)c3o2)=CS2)/C2=N/Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H19N3O2S/c29-21-11-6-9-19(13-21)16-27-28-22(24-14-20-10-4-5-12-23(20)30-24)17-31-25(28)26-15-18-7-2-1-3-8-18/h1-14,16-17,29H,15H2 |
| InChIK | FTUSVXBWKRQWLB-UHFFFAOYSA-N |
| TotalMolweight | 425.511 |
| Molweight | 425.511 |
| MonoisotopicMass | 425.119797 |
| CLogP | 5.628 |
| CLogS | -6.682 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 323.91 |
| Relative PSA | 0.22003 |
| PolarSurfaceArea | 86.63 |
| Druglikeness | 4.418 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45161 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[4-(1-benzofuran-2-yl)-2-benzylimino-1,3-thiazol-3-yl]iminomethyl]phenol | 2 - 3-[(Z)-[4-(1-benzofuran-2-yl)-2-benzylimino-1,3-thiazol-3-yl]iminomethyl]phenol