| MolName | (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine |
| MolecularFormula | C29H27N3O2F2S |
| Smiles | FC(F)Sc(cc1)ccc1-c1ccc(/C=N\N=C/C(CC/C2=C/c3ccccc3)=C2N2CCOCC2)o1 |
| InChI | InChI=1S/C29H27F2N3O2S/c30-29(31)37-26-11-8-22(9-12-26)27-13-10-25(36-27)20-33-32-19-24-7-6-23(18-21-4-2-1-3-5-21)28(24)34-14-16-35-17-15-34/h1-5,8-13,18-20,29H,6-7,14-17H2 |
| InChIK | FTVQKKYDZUUWKK-UHFFFAOYSA-N |
| TotalMolweight | 519.614 |
| Molweight | 519.614 |
| MonoisotopicMass | 519.179203 |
| CLogP | 8.1989 |
| CLogS | -7.627 |
| H Acceptors | 5 |
| TotalSurfaceArea | 398.17 |
| Relative PSA | 0.17121 |
| PolarSurfaceArea | 75.63 |
| Druglikeness | 1.6114 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.59459 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine | 2 - (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine