| MolName | 5-[(Z)-(8-fluoro-2,4-dioxo-1,5-dihydropyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonic acid |
| MolecularFormula | C15H9N4O6FS |
| Smiles | OS(c1ccc(/C=N\N(C(c([nH]c(cc2)c3cc2F)c3N2)=O)C2=O)o1)(=O)=O |
| InChI | InChI=1S/C15H9FN4O6S/c16-7-1-3-10-9(5-7)12-13(18-10)14(21)20(15(22)19-12)17-6-8-2-4-11(26-8)27(23,24)25/h1-6,18H,(H,19,22)(H,23,24,25) |
| InChIK | FULPTORQBJQAKY-UHFFFAOYSA-N |
| TotalMolweight | 392.322 |
| Molweight | 392.322 |
| MonoisotopicMass | 392.022684 |
| CLogP | -0.326 |
| CLogS | -3.012 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 256.68 |
| Relative PSA | 0.47678 |
| PolarSurfaceArea | 153.45 |
| Druglikeness | 5.1265 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-(8-fluoro-2,4-dioxo-1,5-dihydropyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonic acid | 2 - 5-[(Z)-(8-fluoro-2,4-dioxo-1,5-dihydropyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonic acid