| MolName | N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| MolecularFormula | C14H12N3O3Cl |
| Smiles | O=C(C(N/N=C\c(cccc1)c1Cl)=O)NCc1ccco1 |
| InChI | InChI=1S/C14H12ClN3O3/c15-12-6-2-1-4-10(12)8-17-18-14(20)13(19)16-9-11-5-3-7-21-11/h1-8H,9H2,(H,16,19)(H,18,20) |
| InChIK | FUUCXYURUGCAFM-UHFFFAOYSA-N |
| TotalMolweight | 305.72 |
| Molweight | 305.72 |
| MonoisotopicMass | 305.056719 |
| CLogP | 1.648 |
| CLogS | -3.759 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 235.07 |
| Relative PSA | 0.31744 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 3.9186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide | 2 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide