| MolName | 2-[[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| MolecularFormula | C14H9N4O7 |
| Smiles | [O-]C(c(cccc1)c1NC(C(N/N=C\c1ccc([N+]([O-])=O)o1)=O)=O)=O |
| InChI | InChI=1S/C14H10N4O7/c19-12(16-10-4-2-1-3-9(10)14(21)22)13(20)17-15-7-8-5-6-11(25-8)18(23)24/h1-7H,(H,16,19)(H,17,20)(H,21,22)/p-1 |
| InChIK | FUVWHGQHFXXRTH-UHFFFAOYSA-M |
| TotalMolweight | 345.246 |
| Molweight | 345.246 |
| MonoisotopicMass | 345.047126 |
| CLogP | -1.8285 |
| CLogS | -4.205 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 254.84 |
| Relative PSA | 0.51938 |
| PolarSurfaceArea | 169.65 |
| Druglikeness | 2.2125 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate | 2 - 2-[[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate