| MolName | 2-[4-phenyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-5-yl]acetic acid |
| MolecularFormula | C17H14N4O2S |
| Smiles | OC(Cc1c(-c2ccccc2)nc(N/N=C\c2ccncc2)s1)=O |
| InChI | InChI=1S/C17H14N4O2S/c22-15(23)10-14-16(13-4-2-1-3-5-13)20-17(24-14)21-19-11-12-6-8-18-9-7-12/h1-9,11H,10H2,(H,20,21)(H,22,23) |
| InChIK | FVDQXHCLRPAMTR-UHFFFAOYSA-N |
| TotalMolweight | 338.39 |
| Molweight | 338.39 |
| MonoisotopicMass | 338.083746 |
| CLogP | 4.6105 |
| CLogS | -3.953 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 260.32 |
| Relative PSA | 0.35114 |
| PolarSurfaceArea | 115.71 |
| Druglikeness | 3.7426 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-phenyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-5-yl]acetic acid | 2 - 2-[4-phenyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-5-yl]acetic acid