| MolName | 4-[[2-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| MolecularFormula | C23H19N2O5Br |
| Smiles | OC(c1ccc(COc2c(/C=N\NC(COc(cc3)ccc3Br)=O)cccc2)cc1)=O |
| InChI | InChI=1S/C23H19BrN2O5/c24-19-9-11-20(12-10-19)30-15-22(27)26-25-13-18-3-1-2-4-21(18)31-14-16-5-7-17(8-6-16)23(28)29/h1-13H,14-15H2,(H,26,27)(H,28,29) |
| InChIK | FVGIHDSNMOVGHA-UHFFFAOYSA-N |
| TotalMolweight | 483.317 |
| Molweight | 483.317 |
| MonoisotopicMass | 482.047734 |
| CLogP | 4.3349 |
| CLogS | -5.689 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 337 |
| Relative PSA | 0.24377 |
| PolarSurfaceArea | 97.22 |
| Druglikeness | 2.2297 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[[2-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid | 2 - 4-[[2-[(Z)-[[2-(4-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid