| MolName | 4-fluoro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]aniline |
| MolecularFormula | C20H19N4OFS |
| Smiles | Fc(cc1)ccc1N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C20H19FN4OS/c21-16-6-8-17(9-7-16)24-22-14-18-19(15-4-2-1-3-5-15)23-20(27-18)25-10-12-26-13-11-25/h1-9,14,24H,10-13H2 |
| InChIK | FVHIAHJNCPJSRH-UHFFFAOYSA-N |
| TotalMolweight | 382.462 |
| Molweight | 382.462 |
| MonoisotopicMass | 382.126359 |
| CLogP | 6.0684 |
| CLogS | -5.187 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 291.89 |
| Relative PSA | 0.23245 |
| PolarSurfaceArea | 77.99 |
| Druglikeness | 3.2841 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-fluoro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]aniline | 2 - 4-fluoro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]aniline