| MolName | N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-1,3-benzoxazol-2-amine |
| MolecularFormula | C14H9N3OClF |
| Smiles | Fc(cc1)c(/C=N\Nc2nc(cccc3)c3o2)cc1Cl |
| InChI | InChI=1S/C14H9ClFN3O/c15-10-5-6-11(16)9(7-10)8-17-19-14-18-12-3-1-2-4-13(12)20-14/h1-8H,(H,18,19) |
| InChIK | FVKZVEFCAKNBFJ-UHFFFAOYSA-N |
| TotalMolweight | 289.696 |
| Molweight | 289.696 |
| MonoisotopicMass | 289.041817 |
| CLogP | 5.929 |
| CLogS | -5.315 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 214.06 |
| Relative PSA | 0.22447 |
| PolarSurfaceArea | 50.42 |
| Druglikeness | 0.74843 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-1,3-benzoxazol-2-amine | 2 - N-[(Z)-(5-chloro-2-fluorophenyl)methylideneamino]-1,3-benzoxazol-2-amine