| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]formamide |
| MolecularFormula | C8H7N2OCl |
| Smiles | O=CN/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C8H7ClN2O/c9-8-4-2-1-3-7(8)5-10-11-6-12/h1-6H,(H,11,12) |
| InChIK | FVPHAIQPSYMHFH-UHFFFAOYSA-N |
| TotalMolweight | 182.61 |
| Molweight | 182.61 |
| MonoisotopicMass | 182.02469 |
| CLogP | 1.993 |
| CLogS | -3.456 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 144.44 |
| Relative PSA | 0.24931 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.2236 |
| Mutagenic | low |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 12 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]formamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]formamide