| MolName | 4-amino-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide |
| MolecularFormula | C20H17N3O |
| Smiles | Nc(cc1)ccc1C(N/N=C\c(cc1)ccc1-c1ccccc1)=O |
| InChI | InChI=1S/C20H17N3O/c21-19-12-10-18(11-13-19)20(24)23-22-14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-14H,21H2,(H,23,24) |
| InChIK | FVROQVOOTIISQD-UHFFFAOYSA-N |
| TotalMolweight | 315.375 |
| Molweight | 315.375 |
| MonoisotopicMass | 315.137162 |
| CLogP | 4.1835 |
| CLogS | -5.883 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 255.27 |
| Relative PSA | 0.20089 |
| PolarSurfaceArea | 67.48 |
| Druglikeness | 4.3905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide | 2 - 4-amino-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide