| MolName | 4-oxo-2,6-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,4lambda5-oxaphosphinin-4-amine |
| MolecularFormula | C24H18N2O2F3P |
| Smiles | O=P1(C=C(c2ccccc2)OC(c2ccccc2)=C1)N/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C24H18F3N2O2P/c25-24(26,27)21-14-8-7-13-20(21)15-28-29-32(30)16-22(18-9-3-1-4-10-18)31-23(17-32)19-11-5-2-6-12-19/h1-17H,(H,29,30) |
| InChIK | FVWVYRDHFMCYIT-UHFFFAOYSA-N |
| TotalMolweight | 454.387 |
| Molweight | 454.387 |
| MonoisotopicMass | 454.105799 |
| CLogP | 5.6283 |
| CLogS | -4.339 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 328.15 |
| Relative PSA | 0.15234 |
| PolarSurfaceArea | 60.5 |
| Druglikeness | -19.298 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.4375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 4-oxo-2,6-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,4lambda5-oxaphosphinin-4-amine | 2 - 4-oxo-2,6-diphenyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,4lambda5-oxaphosphinin-4-amine