| MolName | 2-(2-chlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C15H13N2O3Cl |
| Smiles | O=C(COc(cccc1)c1Cl)N/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C15H13ClN2O3/c16-13-7-1-2-8-14(13)21-11-15(19)18-17-9-3-5-12-6-4-10-20-12/h1-10H,11H2,(H,18,19) |
| InChIK | FWARTVYLUMPWTL-UHFFFAOYSA-N |
| TotalMolweight | 304.732 |
| Molweight | 304.732 |
| MonoisotopicMass | 304.06147 |
| CLogP | 2.5895 |
| CLogS | -4.211 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 242.36 |
| Relative PSA | 0.24806 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 4.2385 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-chlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide | 2 - 2-(2-chlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide