| MolName | N-[2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| MolecularFormula | C18H17N5O5 |
| Smiles | [O-][N+](c1cc(/C=N\NC(CNC(CNC(c2ccccc2)=O)=O)=O)ccc1)=O |
| InChI | InChI=1S/C18H17N5O5/c24-16(11-20-18(26)14-6-2-1-3-7-14)19-12-17(25)22-21-10-13-5-4-8-15(9-13)23(27)28/h1-10H,11-12H2,(H,19,24)(H,20,26)(H,22,25) |
| InChIK | FXQCKXAFQPRZCF-UHFFFAOYSA-N |
| TotalMolweight | 383.363 |
| Molweight | 383.363 |
| MonoisotopicMass | 383.12297 |
| CLogP | 0.4474 |
| CLogS | -3.715 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 296.6 |
| Relative PSA | 0.38918 |
| PolarSurfaceArea | 145.48 |
| Druglikeness | 0.34954 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide | 2 - N-[2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]benzamide