| MolName | 4-hydroxy-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C20H16N2O3 |
| Smiles | Oc(cc1)ccc1C(N/N=C\c1cc(Oc2ccccc2)ccc1)=O |
| InChI | InChI=1S/C20H16N2O3/c23-17-11-9-16(10-12-17)20(24)22-21-14-15-5-4-8-19(13-15)25-18-6-2-1-3-7-18/h1-14,23H,(H,22,24) |
| InChIK | FXXGGHWEHAALAU-UHFFFAOYSA-N |
| TotalMolweight | 332.358 |
| Molweight | 332.358 |
| MonoisotopicMass | 332.116093 |
| CLogP | 4.2515 |
| CLogS | -5.722 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 263.1 |
| Relative PSA | 0.22467 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.2868 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-hydroxy-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide | 2 - 4-hydroxy-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide