| MolName | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C25H18N4O2Cl2S |
| Smiles | O=C(CSC(N1c(cc2)ccc2Cl)=Nc(cccc2)c2C1=O)N/N=C\C(\Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N4O2S/c26-18-10-12-20(13-11-18)31-24(33)21-8-4-5-9-22(21)29-25(31)34-16-23(32)30-28-15-19(27)14-17-6-2-1-3-7-17/h1-15H,16H2,(H,30,32) |
| InChIK | FXZMMYOPCHHELQ-UHFFFAOYSA-N |
| TotalMolweight | 509.416 |
| Molweight | 509.416 |
| MonoisotopicMass | 508.05275 |
| CLogP | 5.2964 |
| CLogS | -7.844 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 371.07 |
| Relative PSA | 0.2199 |
| PolarSurfaceArea | 99.43 |
| Druglikeness | 5.9907 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide