| MolName | 11-benzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-cyclohexyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| MolecularFormula | C29H30N5OClS |
| Smiles | O=C1N(C2CCCCC2)C(N/N=C\c(cc2)ccc2Cl)=Nc2c1c(CCN(Cc1ccccc1)C1)c1s2 |
| InChI | InChI=1S/C29H30ClN5OS/c30-22-13-11-20(12-14-22)17-31-33-29-32-27-26(28(36)35(29)23-9-5-2-6-10-23)24-15-16-34(19-25(24)37-27)18-21-7-3-1-4-8-21/h1,3-4,7-8,11-14,17,23H,2,5-6,9-10,15-16,18-19H2,(H,32,33) |
| InChIK | FYEIICHFZXXKKZ-UHFFFAOYSA-N |
| TotalMolweight | 532.11 |
| Molweight | 532.11 |
| MonoisotopicMass | 531.185957 |
| CLogP | 6.1984 |
| CLogS | -7.608 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 397.52 |
| Relative PSA | 0.18862 |
| PolarSurfaceArea | 88.54 |
| Druglikeness | 2.6035 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 11-benzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-cyclohexyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one | 2 - 11-benzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-cyclohexyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one