| MolName | 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C14H10N3O3F3S |
| Smiles | [O-][N+](c1c(CC(N/N=C\c2cccs2)=O)ccc(C(F)(F)F)c1)=O |
| InChI | InChI=1S/C14H10F3N3O3S/c15-14(16,17)10-4-3-9(12(7-10)20(22)23)6-13(21)19-18-8-11-2-1-5-24-11/h1-5,7-8H,6H2,(H,19,21) |
| InChIK | FYMVMPRNDNODIP-UHFFFAOYSA-N |
| TotalMolweight | 357.311 |
| Molweight | 357.311 |
| MonoisotopicMass | 357.039496 |
| CLogP | 2.993 |
| CLogS | -4.934 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 249.82 |
| Relative PSA | 0.34741 |
| PolarSurfaceArea | 115.52 |
| Druglikeness | -6.3064 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-[2-nitro-4-(trifluoromethyl)phenyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide