| MolName | 3-phenyl-N-[(Z)-[3-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C28H22N8O2 |
| Smiles | O=C(c1cc(-c2ccccc2)n[nH]1)N/N=C\c1cccc(/C=N\NC(c2cc(-c3ccccc3)n[nH]2)=O)c1 |
| InChI | InChI=1S/C28H22N8O2/c37-27(25-15-23(31-33-25)21-10-3-1-4-11-21)35-29-17-19-8-7-9-20(14-19)18-30-36-28(38)26-16-24(32-34-26)22-12-5-2-6-13-22/h1-18H,(H,31,33)(H,32,34)(H,35,37)(H,36,38) |
| InChIK | FYVAULLYYYPITN-UHFFFAOYSA-N |
| TotalMolweight | 502.537 |
| Molweight | 502.537 |
| MonoisotopicMass | 502.186572 |
| CLogP | 4.1392 |
| CLogS | -6.576 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 396.9 |
| Relative PSA | 0.30723 |
| PolarSurfaceArea | 140.28 |
| Druglikeness | 5.6321 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65789 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 20 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-phenyl-N-[(Z)-[3-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-phenyl-N-[(Z)-[3-[(Z)-[(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1H-pyrazole-5-carboxamide