| MolName | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| MolecularFormula | C18H21N5O4 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CCN(CC2)CCN2c2ccccc2)=O)o1)=O |
| InChI | InChI=1S/C18H21N5O4/c24-17(20-19-14-16-6-7-18(27-16)23(25)26)8-9-21-10-12-22(13-11-21)15-4-2-1-3-5-15/h1-7,14H,8-13H2,(H,20,24) |
| InChIK | FZKWOMIHWFCYEI-UHFFFAOYSA-N |
| TotalMolweight | 371.396 |
| Molweight | 371.396 |
| MonoisotopicMass | 371.159355 |
| CLogP | 0.7713 |
| CLogS | -4.025 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 290.01 |
| Relative PSA | 0.3022 |
| PolarSurfaceArea | 106.9 |
| Druglikeness | 7.9121 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 1 |
| Aromatic Amines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide | 2 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide