| MolName | 2-hydroxy-N-[(Z)-2-phenylethylideneamino]benzamide |
| MolecularFormula | C15H14N2O2 |
| Smiles | Oc(cccc1)c1C(N/N=C\Cc1ccccc1)=O |
| InChI | InChI=1S/C15H14N2O2/c18-14-9-5-4-8-13(14)15(19)17-16-11-10-12-6-2-1-3-7-12/h1-9,11,18H,10H2,(H,17,19) |
| InChIK | FZLZMAMMBJYULF-UHFFFAOYSA-N |
| TotalMolweight | 254.288 |
| Molweight | 254.288 |
| MonoisotopicMass | 254.105528 |
| CLogP | 2.5431 |
| CLogS | -3.312 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 207.1 |
| Relative PSA | 0.23713 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 4.2838 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-2-phenylethylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-2-phenylethylideneamino]benzamide