| MolName | 2-(4,5-dichloroimidazol-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide |
| MolecularFormula | C10H8N4OCl2S |
| Smiles | O=C(Cn(cn1)c(Cl)c1Cl)N/N=C\c1cscc1 |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-9-10(12)16(6-13-9)4-8(17)15-14-3-7-1-2-18-5-7/h1-3,5-6H,4H2,(H,15,17) |
| InChIK | FZNJKAPBDDXUJZ-UHFFFAOYSA-N |
| TotalMolweight | 303.173 |
| Molweight | 303.173 |
| MonoisotopicMass | 301.979585 |
| CLogP | 2.1804 |
| CLogS | -2.564 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 215.49 |
| Relative PSA | 0.34438 |
| PolarSurfaceArea | 87.52 |
| Druglikeness | 6.8669 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4,5-dichloroimidazol-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide | 2 - 2-(4,5-dichloroimidazol-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]acetamide