| MolName | [2,4-dibromo-6-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C20H12N3O3Br2I |
| Smiles | O=C(c1cnccc1)N/N=C\c1cc(Br)cc(Br)c1OC(c(cccc1)c1I)=O |
| InChI | InChI=1S/C20H12Br2IN3O3/c21-14-8-13(11-25-26-19(27)12-4-3-7-24-10-12)18(16(22)9-14)29-20(28)15-5-1-2-6-17(15)23/h1-11H,(H,26,27) |
| InChIK | FZNJQZZLGXJYIX-UHFFFAOYSA-N |
| TotalMolweight | 629.041 |
| Molweight | 629.041 |
| MonoisotopicMass | 626.829012 |
| CLogP | 5.5187 |
| CLogS | -7.08 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 336.8 |
| Relative PSA | 0.2079 |
| PolarSurfaceArea | 80.65 |
| Druglikeness | 2.6621 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 2-iodobenzoate | 2 - [2,4-dibromo-6-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 2-iodobenzoate