| MolName | 4-amino-N-[(Z)-(4-cyanophenyl)methylideneamino]benzamide |
| MolecularFormula | C15H12N4O |
| Smiles | Nc(cc1)ccc1C(N/N=C\c(cc1)ccc1C#N)=O |
| InChI | InChI=1S/C15H12N4O/c16-9-11-1-3-12(4-2-11)10-18-19-15(20)13-5-7-14(17)8-6-13/h1-8,10H,17H2,(H,19,20) |
| InChIK | FZODASNVOXHUFU-UHFFFAOYSA-N |
| TotalMolweight | 264.287 |
| Molweight | 264.287 |
| MonoisotopicMass | 264.101111 |
| CLogP | 2.3599 |
| CLogS | -4.57 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 217.22 |
| Relative PSA | 0.2985 |
| PolarSurfaceArea | 91.27 |
| Druglikeness | 0.1105 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(4-cyanophenyl)methylideneamino]benzamide | 2 - 4-amino-N-[(Z)-(4-cyanophenyl)methylideneamino]benzamide