| MolName | 5-chloro-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1H-pyridazin-6-one |
| MolecularFormula | C13H11N4OCl |
| Smiles | O=C1NN=CC(N/N=C\C=C\c2ccccc2)=C1Cl |
| InChI | InChI=1S/C13H11ClN4O/c14-12-11(9-16-18-13(12)19)17-15-8-4-7-10-5-2-1-3-6-10/h1-9H,(H2,17,18,19) |
| InChIK | GAAJAKKWZSDRMV-UHFFFAOYSA-N |
| TotalMolweight | 274.71 |
| Molweight | 274.71 |
| MonoisotopicMass | 274.062138 |
| CLogP | 1.6511 |
| CLogS | -4.167 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 214.79 |
| Relative PSA | 0.27459 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 3.742 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; 2-halo-enone |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-chloro-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1H-pyridazin-6-one | 2 - 5-chloro-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1H-pyridazin-6-one